About N-(1H-pyrazol-4-ylmethyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine
N-(1H-pyrazol-4-ylmethyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 104730831) has the molecular formula C11H9F3N6
and a molecular weight of 282.23 g/mol. Its IUPAC name is N-(1H-pyrazol-4-ylmethyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine.
Molecular Properties
| Compound Name | N-(1H-pyrazol-4-ylmethyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine |
| PubChem CID | 104730831 |
| Molecular Formula | C11H9F3N6 |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | N-(1H-pyrazol-4-ylmethyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | FC(F)(F)c1cc2c(NCc3cn[nH]c3)nccn2n1 |
| InChI | InChI=1S/C11H9F3N6/c12-11(13,14)9-3-8-10(15-1-2-20(8)19-9)16-4-7-5-17-18-6-7/h1-3,5-6H,4H2,(H,15,16)(H,17,18) |
| InChIKey | NIQGRLBQZIUWFF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1H-pyrazol-4-ylmethyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-pyrazol-4-ylmethyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine?
The IUPAC name of N-(1H-pyrazol-4-ylmethyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine (CID 104730831) is N-(1H-pyrazol-4-ylmethyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine.
What is the SMILES notation for N-(1H-pyrazol-4-ylmethyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine?
The canonical SMILES for N-(1H-pyrazol-4-ylmethyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine is FC(F)(F)c1cc2c(NCc3cn[nH]c3)nccn2n1.
What is the InChIKey of N-(1H-pyrazol-4-ylmethyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine?
The InChIKey is NIQGRLBQZIUWFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F3N6/c12-11(13,14)9-3-8-10(15-1-2-20(8)19-9)16-4-7-5-17-18-6-7/h1-3,5-6H,4H2,(H,15,16)(H,17,18).
What are the key properties of N-(1H-pyrazol-4-ylmethyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine?
N-(1H-pyrazol-4-ylmethyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine has a molecular weight of 282.23 g/mol, XLogP of 2.08, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-pyrazol-4-ylmethyl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazin-4-amine is sourced from PubChem (CID 104730831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).