C23H30N2O — CID 10473101
trans-(1S,2R)-2-(2,2-diphenylhydrazinyl)-1-pent-4-enylcyclohexan-1-ol (PubChem CID 10473101) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is trans-(1S,2R)-2-(2,2-diphenylhydrazinyl)-1-pent-4-enylcyclohexan-1-ol.
| Compound Name | trans-(1S,2R)-2-(2,2-diphenylhydrazinyl)-1-pent-4-enylcyclohexan-1-ol |
|---|---|
| PubChem CID | 10473101 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | trans-(1S,2R)-2-(2,2-diphenylhydrazinyl)-1-pent-4-enylcyclohexan-1-ol |
| SMILES | C=CCCC[C@@]1(O)CCCC[C@H]1NN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30N2O/c1-2-3-11-18-23(26)19-12-10-17-22(23)24-25(20-13-6-4-7-14-20)21-15-8-5-9-16-21/h2,4-9,13-16,22,24,26H,1,3,10-12,17-19H2/t22-,23-/m1/s1 |
| InChIKey | MQHIHOGQUDZKFG-DHIUTWEWSA-N |
| XLogP | 5.36 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|