C15H24N4 — CID 104731079
2-methyl-N-octan-2-ylpyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 104731079) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-methyl-N-octan-2-ylpyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | 2-methyl-N-octan-2-ylpyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 104731079 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 2-methyl-N-octan-2-ylpyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | CCCCCCC(C)Nc1nccn2nc(C)cc12 |
| InChI | InChI=1S/C15H24N4/c1-4-5-6-7-8-12(2)17-15-14-11-13(3)18-19(14)10-9-16-15/h9-12H,4-8H2,1-3H3,(H,16,17) |
| InChIKey | AGIQSROUGFZUBC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|