About [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(4-chloro-N-methylanilino)butanoate
[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(4-chloro-N-methylanilino)butanoate (PubChem CID 10473109) has the molecular formula C19H27ClN2O2
and a molecular weight of 350.89 g/mol. Its IUPAC name is [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(4-chloro-N-methylanilino)butanoate.
Molecular Properties
| Compound Name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(4-chloro-N-methylanilino)butanoate |
| PubChem CID | 10473109 |
| Molecular Formula | C19H27ClN2O2 |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(4-chloro-N-methylanilino)butanoate |
| SMILES | CCC(C(=O)OC1C[C@H]2CC[C@@H](C1)N2C)N(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H27ClN2O2/c1-4-18(22(3)14-7-5-13(20)6-8-14)19(23)24-17-11-15-9-10-16(12-17)21(15)2/h5-8,15-18H,4,9-12H2,1-3H3/t15-,16+,17?,18? |
| InChIKey | ABANHPVMOWARPS-OQSMONGASA-N |
| XLogP | 3.72 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(4-chloro-N-methylanilino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(4-chloro-N-methylanilino)butanoate?
The IUPAC name of [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(4-chloro-N-methylanilino)butanoate (CID 10473109) is [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(4-chloro-N-methylanilino)butanoate.
What is the SMILES notation for [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(4-chloro-N-methylanilino)butanoate?
The canonical SMILES for [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(4-chloro-N-methylanilino)butanoate is CCC(C(=O)OC1C[C@H]2CC[C@@H](C1)N2C)N(C)c1ccc(Cl)cc1.
What is the InChIKey of [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(4-chloro-N-methylanilino)butanoate?
The InChIKey is ABANHPVMOWARPS-OQSMONGASA-N. The full InChI is InChI=1S/C19H27ClN2O2/c1-4-18(22(3)14-7-5-13(20)6-8-14)19(23)24-17-11-15-9-10-16(12-17)21(15)2/h5-8,15-18H,4,9-12H2,1-3H3/t15-,16+,17?,18?.
What are the key properties of [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(4-chloro-N-methylanilino)butanoate?
[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(4-chloro-N-methylanilino)butanoate has a molecular weight of 350.89 g/mol, XLogP of 3.72, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(4-chloro-N-methylanilino)butanoate is sourced from PubChem (CID 10473109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).