About N-[(4-methylcyclohexyl)methyl]-2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-amine
N-[(4-methylcyclohexyl)methyl]-2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 104731430) has the molecular formula C17H26N4
and a molecular weight of 286.42 g/mol. Its IUPAC name is N-[(4-methylcyclohexyl)methyl]-2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-amine.
Molecular Properties
| Compound Name | N-[(4-methylcyclohexyl)methyl]-2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-amine |
| PubChem CID | 104731430 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | N-[(4-methylcyclohexyl)methyl]-2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | CC1CCC(CNc2nccn3nc(C(C)C)cc23)CC1 |
| InChI | InChI=1S/C17H26N4/c1-12(2)15-10-16-17(18-8-9-21(16)20-15)19-11-14-6-4-13(3)5-7-14/h8-10,12-14H,4-7,11H2,1-3H3,(H,18,19) |
| InChIKey | ADQUNDFSASDMNE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(4-methylcyclohexyl)methyl]-2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-methylcyclohexyl)methyl]-2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-amine?
The IUPAC name of N-[(4-methylcyclohexyl)methyl]-2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-amine (CID 104731430) is N-[(4-methylcyclohexyl)methyl]-2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-amine.
What is the SMILES notation for N-[(4-methylcyclohexyl)methyl]-2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-amine?
The canonical SMILES for N-[(4-methylcyclohexyl)methyl]-2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-amine is CC1CCC(CNc2nccn3nc(C(C)C)cc23)CC1.
What is the InChIKey of N-[(4-methylcyclohexyl)methyl]-2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-amine?
The InChIKey is ADQUNDFSASDMNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N4/c1-12(2)15-10-16-17(18-8-9-21(16)20-15)19-11-14-6-4-13(3)5-7-14/h8-10,12-14H,4-7,11H2,1-3H3,(H,18,19).
What are the key properties of N-[(4-methylcyclohexyl)methyl]-2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-amine?
N-[(4-methylcyclohexyl)methyl]-2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-amine has a molecular weight of 286.42 g/mol, XLogP of 4.09, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-methylcyclohexyl)methyl]-2-propan-2-ylpyrazolo[1,5-a]pyrazin-4-amine is sourced from PubChem (CID 104731430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).