About N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine
N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 104731965) has the molecular formula C8H8F2N4
and a molecular weight of 198.18 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine.
Molecular Properties
| Compound Name | N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine |
| PubChem CID | 104731965 |
| Molecular Formula | C8H8F2N4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | FC(F)CNc1nccn2nccc12 |
| InChI | InChI=1S/C8H8F2N4/c9-7(10)5-12-8-6-1-2-13-14(6)4-3-11-8/h1-4,7H,5H2,(H,11,12) |
| InChIKey | ICQFHVCUFBYEIC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine?
The IUPAC name of N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine (CID 104731965) is N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine.
What is the SMILES notation for N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine?
The canonical SMILES for N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine is FC(F)CNc1nccn2nccc12.
What is the InChIKey of N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine?
The InChIKey is ICQFHVCUFBYEIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F2N4/c9-7(10)5-12-8-6-1-2-13-14(6)4-3-11-8/h1-4,7H,5H2,(H,11,12).
What are the key properties of N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine?
N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine has a molecular weight of 198.18 g/mol, XLogP of 1.41, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoroethyl)pyrazolo[1,5-a]pyrazin-4-amine is sourced from PubChem (CID 104731965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).