C10H11F3N4 — CID 104731975
N-(4,4,4-trifluorobutyl)pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 104731975) has the molecular formula C10H11F3N4 and a molecular weight of 244.22 g/mol. Its IUPAC name is N-(4,4,4-trifluorobutyl)pyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | N-(4,4,4-trifluorobutyl)pyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 104731975 |
| Molecular Formula | C10H11F3N4 |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | N-(4,4,4-trifluorobutyl)pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | FC(F)(F)CCCNc1nccn2nccc12 |
| InChI | InChI=1S/C10H11F3N4/c11-10(12,13)3-1-4-14-9-8-2-5-16-17(8)7-6-15-9/h2,5-7H,1,3-4H2,(H,14,15) |
| InChIKey | RIJQDSPQGKGIPY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|