About 5-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-3-phenyl-2,1-benzoxazole
5-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-3-phenyl-2,1-benzoxazole (PubChem CID 10473198) has the molecular formula C22H16N4O
and a molecular weight of 352.40 g/mol. Its IUPAC name is 5-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-3-phenyl-2,1-benzoxazole.
Molecular Properties
| Compound Name | 5-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-3-phenyl-2,1-benzoxazole |
| PubChem CID | 10473198 |
| Molecular Formula | C22H16N4O |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 5-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-3-phenyl-2,1-benzoxazole |
| SMILES | Cc1cccc(-c2[nH]ncc2-c2ccc3noc(-c4ccccc4)c3c2)n1 |
| InChI | InChI=1S/C22H16N4O/c1-14-6-5-9-20(24-14)21-18(13-23-25-21)16-10-11-19-17(12-16)22(27-26-19)15-7-3-2-4-8-15/h2-13H,1H3,(H,23,25) |
| InChIKey | ZZQJVHSWPITQLK-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-3-phenyl-2,1-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-3-phenyl-2,1-benzoxazole?
The IUPAC name of 5-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-3-phenyl-2,1-benzoxazole (CID 10473198) is 5-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-3-phenyl-2,1-benzoxazole.
What is the SMILES notation for 5-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-3-phenyl-2,1-benzoxazole?
The canonical SMILES for 5-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-3-phenyl-2,1-benzoxazole is Cc1cccc(-c2[nH]ncc2-c2ccc3noc(-c4ccccc4)c3c2)n1.
What is the InChIKey of 5-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-3-phenyl-2,1-benzoxazole?
The InChIKey is ZZQJVHSWPITQLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N4O/c1-14-6-5-9-20(24-14)21-18(13-23-25-21)16-10-11-19-17(12-16)22(27-26-19)15-7-3-2-4-8-15/h2-13H,1H3,(H,23,25).
What are the key properties of 5-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-3-phenyl-2,1-benzoxazole?
5-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-3-phenyl-2,1-benzoxazole has a molecular weight of 352.40 g/mol, XLogP of 5.26, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]-3-phenyl-2,1-benzoxazole is sourced from PubChem (CID 10473198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).