C21H40O2Si — CID 10473237
tert-butyl-[(2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienoxy]-dimethylsilane (PubChem CID 10473237) has the molecular formula C21H40O2Si and a molecular weight of 352.64 g/mol. Its IUPAC name is tert-butyl-[(2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10473237 |
| Molecular Formula | C21H40O2Si |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | tert-butyl-[(2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienoxy]-dimethylsilane |
| SMILES | C/C(=C\CO[Si](C)(C)C(C)(C)C)CC/C=C(\C)CCC1OC1(C)C |
| InChI | InChI=1S/C21H40O2Si/c1-17(13-14-19-21(6,7)23-19)11-10-12-18(2)15-16-22-24(8,9)20(3,4)5/h11,15,19H,10,12-14,16H2,1-9H3/b17-11+,18-15+ |
| InChIKey | ZZEOHVGYNLZCOA-OVHYJKADSA-N |
| XLogP | 6.64 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|