C21H40O2Si — CID 10473238
2-[(1R,2R,6S,7S)-2-[tert-butyl(dimethyl)silyl]oxy-6,7,9,9-tetramethyl-7-bicyclo[4.2.1]nonanyl]acetaldehyde (PubChem CID 10473238) has the molecular formula C21H40O2Si and a molecular weight of 352.64 g/mol. Its IUPAC name is 2-[(1R,2R,6S,7S)-2-[tert-butyl(dimethyl)silyl]oxy-6,7,9,9-tetramethyl-7-bicyclo[4.2.1]nonanyl]acetaldehyde.
| Compound Name | 2-[(1R,2R,6S,7S)-2-[tert-butyl(dimethyl)silyl]oxy-6,7,9,9-tetramethyl-7-bicyclo[4.2.1]nonanyl]acetaldehyde |
|---|---|
| PubChem CID | 10473238 |
| Molecular Formula | C21H40O2Si |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | 2-[(1R,2R,6S,7S)-2-[tert-butyl(dimethyl)silyl]oxy-6,7,9,9-tetramethyl-7-bicyclo[4.2.1]nonanyl]acetaldehyde |
| SMILES | CC1(C)[C@H]2C[C@@](C)(CC=O)[C@]1(C)CCC[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O2Si/c1-18(2,3)24(8,9)23-17-11-10-12-21(7)19(4,5)16(17)15-20(21,6)13-14-22/h14,16-17H,10-13,15H2,1-9H3/t16-,17+,20+,21+/m0/s1 |
| InChIKey | DMSPKSCMHDRJMO-XWDORNJCSA-N |
| XLogP | 6.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|