About 4-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine
4-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine (PubChem CID 104732607) has the molecular formula C13H16F3N5
and a molecular weight of 299.30 g/mol. Its IUPAC name is 4-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine.
Molecular Properties
| Compound Name | 4-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine |
| PubChem CID | 104732607 |
| Molecular Formula | C13H16F3N5 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 4-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine |
| SMILES | CC1CN(c2nccn3nc(C(F)(F)F)cc23)C(C)CN1 |
| InChI | InChI=1S/C13H16F3N5/c1-8-7-20(9(2)6-18-8)12-10-5-11(13(14,15)16)19-21(10)4-3-17-12/h3-5,8-9,18H,6-7H2,1-2H3 |
| InChIKey | SVTBFVUUMOIIMS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine?
The IUPAC name of 4-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine (CID 104732607) is 4-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine.
What is the SMILES notation for 4-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine?
The canonical SMILES for 4-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine is CC1CN(c2nccn3nc(C(F)(F)F)cc23)C(C)CN1.
What is the InChIKey of 4-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine?
The InChIKey is SVTBFVUUMOIIMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F3N5/c1-8-7-20(9(2)6-18-8)12-10-5-11(13(14,15)16)19-21(10)4-3-17-12/h3-5,8-9,18H,6-7H2,1-2H3.
What are the key properties of 4-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine?
4-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine has a molecular weight of 299.30 g/mol, XLogP of 1.93, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dimethylpiperazin-1-yl)-2-(trifluoromethyl)pyrazolo[1,5-a]pyrazine is sourced from PubChem (CID 104732607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).