C11H13ClN4 — CID 104733876
4-(3-chloropyrrolidin-1-yl)-2-methylpyrazolo[1,5-a]pyrazine (PubChem CID 104733876) has the molecular formula C11H13ClN4 and a molecular weight of 236.71 g/mol. Its IUPAC name is 4-(3-chloropyrrolidin-1-yl)-2-methylpyrazolo[1,5-a]pyrazine.
| Compound Name | 4-(3-chloropyrrolidin-1-yl)-2-methylpyrazolo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 104733876 |
| Molecular Formula | C11H13ClN4 |
| Molecular Weight | 236.71 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 4-(3-chloropyrrolidin-1-yl)-2-methylpyrazolo[1,5-a]pyrazine |
| SMILES | Cc1cc2c(N3CCC(Cl)C3)nccn2n1 |
| InChI | InChI=1S/C11H13ClN4/c1-8-6-10-11(13-3-5-16(10)14-8)15-4-2-9(12)7-15/h3,5-6,9H,2,4,7H2,1H3 |
| InChIKey | CNEZQDXBPQRLPX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.71 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|