C12H17BrN4 — CID 104734102
N-(2-bromoethyl)-2-methyl-N-propylpyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 104734102) has the molecular formula C12H17BrN4 and a molecular weight of 297.20 g/mol. Its IUPAC name is N-(2-bromoethyl)-2-methyl-N-propylpyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | N-(2-bromoethyl)-2-methyl-N-propylpyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 104734102 |
| Molecular Formula | C12H17BrN4 |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | N-(2-bromoethyl)-2-methyl-N-propylpyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | CCCN(CCBr)c1nccn2nc(C)cc12 |
| InChI | InChI=1S/C12H17BrN4/c1-3-6-16(7-4-13)12-11-9-10(2)15-17(11)8-5-14-12/h5,8-9H,3-4,6-7H2,1-2H3 |
| InChIKey | DWYSPOWXQICQAR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|