About 4-pyrazol-1-ylpyrazolo[1,5-a]pyrazine
4-pyrazol-1-ylpyrazolo[1,5-a]pyrazine (PubChem CID 104734365) has the molecular formula C9H7N5
and a molecular weight of 185.19 g/mol. Its IUPAC name is 4-pyrazol-1-ylpyrazolo[1,5-a]pyrazine.
Molecular Properties
| Compound Name | 4-pyrazol-1-ylpyrazolo[1,5-a]pyrazine |
| PubChem CID | 104734365 |
| Molecular Formula | C9H7N5 |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 4-pyrazol-1-ylpyrazolo[1,5-a]pyrazine |
| SMILES | c1cnn(-c2nccn3nccc23)c1 |
| InChI | InChI=1S/C9H7N5/c1-3-11-14(6-1)9-8-2-4-12-13(8)7-5-10-9/h1-7H |
| InChIKey | AOGXQKPOXHTYQD-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-pyrazol-1-ylpyrazolo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrazol-1-ylpyrazolo[1,5-a]pyrazine?
The IUPAC name of 4-pyrazol-1-ylpyrazolo[1,5-a]pyrazine (CID 104734365) is 4-pyrazol-1-ylpyrazolo[1,5-a]pyrazine.
What is the SMILES notation for 4-pyrazol-1-ylpyrazolo[1,5-a]pyrazine?
The canonical SMILES for 4-pyrazol-1-ylpyrazolo[1,5-a]pyrazine is c1cnn(-c2nccn3nccc23)c1.
What is the InChIKey of 4-pyrazol-1-ylpyrazolo[1,5-a]pyrazine?
The InChIKey is AOGXQKPOXHTYQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N5/c1-3-11-14(6-1)9-8-2-4-12-13(8)7-5-10-9/h1-7H.
What are the key properties of 4-pyrazol-1-ylpyrazolo[1,5-a]pyrazine?
4-pyrazol-1-ylpyrazolo[1,5-a]pyrazine has a molecular weight of 185.19 g/mol, XLogP of 0.92, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrazol-1-ylpyrazolo[1,5-a]pyrazine is sourced from PubChem (CID 104734365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).