C18H28O7 — CID 10473452
[(1R,4R,5S,7R,8S)-7-heptyl-7-methoxy-9-oxo-2,6,10-trioxatricyclo[6.3.0.01,5]undecan-4-yl] acetate (PubChem CID 10473452) has the molecular formula C18H28O7 and a molecular weight of 356.42 g/mol. Its IUPAC name is [(1R,4R,5S,7R,8S)-7-heptyl-7-methoxy-9-oxo-2,6,10-trioxatricyclo[6.3.0.01,5]undecan-4-yl] acetate.
| Compound Name | [(1R,4R,5S,7R,8S)-7-heptyl-7-methoxy-9-oxo-2,6,10-trioxatricyclo[6.3.0.01,5]undecan-4-yl] acetate |
|---|---|
| PubChem CID | 10473452 |
| Molecular Formula | C18H28O7 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | [(1R,4R,5S,7R,8S)-7-heptyl-7-methoxy-9-oxo-2,6,10-trioxatricyclo[6.3.0.01,5]undecan-4-yl] acetate |
| SMILES | CCCCCCC[C@@]1(OC)O[C@H]2[C@H](OC(C)=O)CO[C@]23COC(=O)[C@H]13 |
| InChI | InChI=1S/C18H28O7/c1-4-5-6-7-8-9-18(21-3)14-16(20)22-11-17(14)15(25-18)13(10-23-17)24-12(2)19/h13-15H,4-11H2,1-3H3/t13-,14+,15+,17+,18-/m1/s1 |
| InChIKey | DTYXGNYEYIHFDZ-CFVWQIKISA-N |
| XLogP | 1.96 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|