About 5-[2-hydroxy-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one
5-[2-hydroxy-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one (PubChem CID 104734857) has the molecular formula C10H14N4O2
and a molecular weight of 222.25 g/mol. Its IUPAC name is 5-[2-hydroxy-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one.
Molecular Properties
| Compound Name | 5-[2-hydroxy-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one |
| PubChem CID | 104734857 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 5-[2-hydroxy-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one |
| SMILES | CNCC(O)Cn1ccn2nccc2c1=O |
| InChI | InChI=1S/C10H14N4O2/c1-11-6-8(15)7-13-4-5-14-9(10(13)16)2-3-12-14/h2-5,8,11,15H,6-7H2,1H3 |
| InChIKey | DTPRDGSLBWKEEL-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 71.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[2-hydroxy-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-hydroxy-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one?
The IUPAC name of 5-[2-hydroxy-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one (CID 104734857) is 5-[2-hydroxy-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one.
What is the SMILES notation for 5-[2-hydroxy-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one?
The canonical SMILES for 5-[2-hydroxy-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one is CNCC(O)Cn1ccn2nccc2c1=O.
What is the InChIKey of 5-[2-hydroxy-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one?
The InChIKey is DTPRDGSLBWKEEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O2/c1-11-6-8(15)7-13-4-5-14-9(10(13)16)2-3-12-14/h2-5,8,11,15H,6-7H2,1H3.
What are the key properties of 5-[2-hydroxy-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one?
5-[2-hydroxy-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one has a molecular weight of 222.25 g/mol, XLogP of -0.92, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-hydroxy-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one is sourced from PubChem (CID 104734857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).