About 5-[2-methyl-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one
5-[2-methyl-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one (PubChem CID 104735161) has the molecular formula C11H16N4O
and a molecular weight of 220.28 g/mol. Its IUPAC name is 5-[2-methyl-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one.
Molecular Properties
| Compound Name | 5-[2-methyl-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one |
| PubChem CID | 104735161 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 5-[2-methyl-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one |
| SMILES | CNCC(C)Cn1ccn2nccc2c1=O |
| InChI | InChI=1S/C11H16N4O/c1-9(7-12-2)8-14-5-6-15-10(11(14)16)3-4-13-15/h3-6,9,12H,7-8H2,1-2H3 |
| InChIKey | CFFVMZKDHOZCSO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 51.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[2-methyl-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-methyl-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one?
The IUPAC name of 5-[2-methyl-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one (CID 104735161) is 5-[2-methyl-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one.
What is the SMILES notation for 5-[2-methyl-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one?
The canonical SMILES for 5-[2-methyl-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one is CNCC(C)Cn1ccn2nccc2c1=O.
What is the InChIKey of 5-[2-methyl-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one?
The InChIKey is CFFVMZKDHOZCSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O/c1-9(7-12-2)8-14-5-6-15-10(11(14)16)3-4-13-15/h3-6,9,12H,7-8H2,1-2H3.
What are the key properties of 5-[2-methyl-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one?
5-[2-methyl-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one has a molecular weight of 220.28 g/mol, XLogP of 0.35, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-methyl-3-(methylamino)propyl]pyrazolo[1,5-a]pyrazin-4-one is sourced from PubChem (CID 104735161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).