C13H13N5O3 — CID 104735546
5-methyl-4-[(4-oxopyrazolo[1,5-a]pyrazin-5-yl)methyl]furan-2-carbohydrazide (PubChem CID 104735546) has the molecular formula C13H13N5O3 and a molecular weight of 287.28 g/mol. Its IUPAC name is 5-methyl-4-[(4-oxopyrazolo[1,5-a]pyrazin-5-yl)methyl]furan-2-carbohydrazide.
| Compound Name | 5-methyl-4-[(4-oxopyrazolo[1,5-a]pyrazin-5-yl)methyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 104735546 |
| Molecular Formula | C13H13N5O3 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 5-methyl-4-[(4-oxopyrazolo[1,5-a]pyrazin-5-yl)methyl]furan-2-carbohydrazide |
| SMILES | Cc1oc(C(=O)NN)cc1Cn1ccn2nccc2c1=O |
| InChI | InChI=1S/C13H13N5O3/c1-8-9(6-11(21-8)12(19)16-14)7-17-4-5-18-10(13(17)20)2-3-15-18/h2-6H,7,14H2,1H3,(H,16,19) |
| InChIKey | KCFFSTUYYIHXIK-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|