C22H20N2O3 — CID 10473681
2-[3-(6-methoxyquinolin-4-yl)-2,5-dimethylindol-1-yl]acetic acid (PubChem CID 10473681) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-[3-(6-methoxyquinolin-4-yl)-2,5-dimethylindol-1-yl]acetic acid.
| Compound Name | 2-[3-(6-methoxyquinolin-4-yl)-2,5-dimethylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 10473681 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-[3-(6-methoxyquinolin-4-yl)-2,5-dimethylindol-1-yl]acetic acid |
| SMILES | COc1ccc2nccc(-c3c(C)n(CC(=O)O)c4ccc(C)cc34)c2c1 |
| InChI | InChI=1S/C22H20N2O3/c1-13-4-7-20-18(10-13)22(14(2)24(20)12-21(25)26)16-8-9-23-19-6-5-15(27-3)11-17(16)19/h4-11H,12H2,1-3H3,(H,25,26) |
| InChIKey | LVUHPSMXFCXPEB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |