C15H12F5N3O2 — CID 10473722
ethyl 2-amino-6-(1,1,2,2,2-pentafluoroethyl)-5-pyridin-4-ylpyridine-3-carboxylate (PubChem CID 10473722) has the molecular formula C15H12F5N3O2 and a molecular weight of 361.27 g/mol. Its IUPAC name is ethyl 2-amino-6-(1,1,2,2,2-pentafluoroethyl)-5-pyridin-4-ylpyridine-3-carboxylate.
| Compound Name | ethyl 2-amino-6-(1,1,2,2,2-pentafluoroethyl)-5-pyridin-4-ylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 10473722 |
| Molecular Formula | C15H12F5N3O2 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | ethyl 2-amino-6-(1,1,2,2,2-pentafluoroethyl)-5-pyridin-4-ylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccncc2)c(C(F)(F)C(F)(F)F)nc1N |
| InChI | InChI=1S/C15H12F5N3O2/c1-2-25-13(24)10-7-9(8-3-5-22-6-4-8)11(23-12(10)21)14(16,17)15(18,19)20/h3-7H,2H2,1H3,(H2,21,23) |
| InChIKey | NLEHLKMXOWIIOT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|