About 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylic acid
11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylic acid (PubChem CID 10473838) has the molecular formula C22H18O3S
and a molecular weight of 362.45 g/mol. Its IUPAC name is 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylic acid.
Molecular Properties
| Compound Name | 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylic acid |
| PubChem CID | 10473838 |
| Molecular Formula | C22H18O3S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(SCc1ccccc1)c1ccccc1CO2 |
| InChI | InChI=1S/C22H18O3S/c23-22(24)16-10-11-20-19(12-16)21(26-14-15-6-2-1-3-7-15)18-9-5-4-8-17(18)13-25-20/h1-12,21H,13-14H2,(H,23,24) |
| InChIKey | MOHCIIDBJLWIHN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylic acid?
The IUPAC name of 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylic acid (CID 10473838) is 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylic acid.
What is the SMILES notation for 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylic acid?
The canonical SMILES for 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylic acid is O=C(O)c1ccc2c(c1)C(SCc1ccccc1)c1ccccc1CO2.
What is the InChIKey of 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylic acid?
The InChIKey is MOHCIIDBJLWIHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18O3S/c23-22(24)16-10-11-20-19(12-16)21(26-14-15-6-2-1-3-7-15)18-9-5-4-8-17(18)13-25-20/h1-12,21H,13-14H2,(H,23,24).
What are the key properties of 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylic acid?
11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylic acid has a molecular weight of 362.45 g/mol, XLogP of 5.30, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-benzylsulfanyl-6,11-dihydrobenzo[c][1]benzoxepine-2-carboxylic acid is sourced from PubChem (CID 10473838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).