C11H13FN4 — CID 104738570
N-[(3-fluoro-4-pyridinyl)-(1H-imidazol-2-yl)methyl]ethanamine (PubChem CID 104738570) has the molecular formula C11H13FN4 and a molecular weight of 220.25 g/mol. Its IUPAC name is N-[(3-fluoro-4-pyridinyl)-(1H-imidazol-2-yl)methyl]ethanamine.
| Compound Name | N-[(3-fluoro-4-pyridinyl)-(1H-imidazol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 104738570 |
| Molecular Formula | C11H13FN4 |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | N-[(3-fluoro-4-pyridinyl)-(1H-imidazol-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1ncc[nH]1)c1ccncc1F |
| InChI | InChI=1S/C11H13FN4/c1-2-14-10(11-15-5-6-16-11)8-3-4-13-7-9(8)12/h3-7,10,14H,2H2,1H3,(H,15,16) |
| InChIKey | VJBCSLKGOZDAKS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |