C13H21N3 — CID 104739730
2-[(2,6-dimethylpiperidin-1-yl)methyl]pyridin-3-amine (PubChem CID 104739730) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-[(2,6-dimethylpiperidin-1-yl)methyl]pyridin-3-amine.
| Compound Name | 2-[(2,6-dimethylpiperidin-1-yl)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 104739730 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 2-[(2,6-dimethylpiperidin-1-yl)methyl]pyridin-3-amine |
| SMILES | CC1CCCC(C)N1Cc1ncccc1N |
| InChI | InChI=1S/C13H21N3/c1-10-5-3-6-11(2)16(10)9-13-12(14)7-4-8-15-13/h4,7-8,10-11H,3,5-6,9,14H2,1-2H3 |
| InChIKey | GSFJOCIEBSNODS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |