C13H23N3O2 — CID 104739958
2-[[2-methoxyethyl(1-methoxypropan-2-yl)amino]methyl]pyridin-3-amine (PubChem CID 104739958) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-[[2-methoxyethyl(1-methoxypropan-2-yl)amino]methyl]pyridin-3-amine.
| Compound Name | 2-[[2-methoxyethyl(1-methoxypropan-2-yl)amino]methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 104739958 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2-[[2-methoxyethyl(1-methoxypropan-2-yl)amino]methyl]pyridin-3-amine |
| SMILES | COCCN(Cc1ncccc1N)C(C)COC |
| InChI | InChI=1S/C13H23N3O2/c1-11(10-18-3)16(7-8-17-2)9-13-12(14)5-4-6-15-13/h4-6,11H,7-10,14H2,1-3H3 |
| InChIKey | KELHNCWSBWRKON-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |