C12H17N5 — CID 104740060
2-[[methyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]pyridin-3-amine (PubChem CID 104740060) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-[[methyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]pyridin-3-amine.
| Compound Name | 2-[[methyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 104740060 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 2-[[methyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]pyridin-3-amine |
| SMILES | CN(Cc1ncccc1N)Cc1nccn1C |
| InChI | InChI=1S/C12H17N5/c1-16(9-12-15-6-7-17(12)2)8-11-10(13)4-3-5-14-11/h3-7H,8-9,13H2,1-2H3 |
| InChIKey | AIPUBIZOHZJLEH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |