C9H14N4O3S — CID 104741062
3-amino-N-[2-(methanesulfonamido)ethyl]pyridine-2-carboxamide (PubChem CID 104741062) has the molecular formula C9H14N4O3S and a molecular weight of 258.30 g/mol. Its IUPAC name is 3-amino-N-[2-(methanesulfonamido)ethyl]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[2-(methanesulfonamido)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 104741062 |
| Molecular Formula | C9H14N4O3S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 3-amino-N-[2-(methanesulfonamido)ethyl]pyridine-2-carboxamide |
| SMILES | CS(=O)(=O)NCCNC(=O)c1ncccc1N |
| InChI | InChI=1S/C9H14N4O3S/c1-17(15,16)13-6-5-12-9(14)8-7(10)3-2-4-11-8/h2-4,13H,5-6,10H2,1H3,(H,12,14) |
| InChIKey | LDUQBEQVWOPQPI-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|