C11H15N3O2 — CID 104742252
(3-amino-2-pyridinyl)-(1,4-oxazepan-4-yl)methanone (PubChem CID 104742252) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is (3-amino-2-pyridinyl)-(1,4-oxazepan-4-yl)methanone.
| Compound Name | (3-amino-2-pyridinyl)-(1,4-oxazepan-4-yl)methanone |
|---|---|
| PubChem CID | 104742252 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (3-amino-2-pyridinyl)-(1,4-oxazepan-4-yl)methanone |
| SMILES | Nc1cccnc1C(=O)N1CCCOCC1 |
| InChI | InChI=1S/C11H15N3O2/c12-9-3-1-4-13-10(9)11(15)14-5-2-7-16-8-6-14/h1,3-4H,2,5-8,12H2 |
| InChIKey | KZTPVCBWDZGCNO-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |