About 2-[(2-anilino-4,4-dimethyl-6-oxocyclohexen-1-yl)-phenylmethyl]propanedinitrile
2-[(2-anilino-4,4-dimethyl-6-oxocyclohexen-1-yl)-phenylmethyl]propanedinitrile (PubChem CID 10474258) has the molecular formula C24H23N3O
and a molecular weight of 369.47 g/mol. Its IUPAC name is 2-[(2-anilino-4,4-dimethyl-6-oxocyclohexen-1-yl)-phenylmethyl]propanedinitrile.
Molecular Properties
| Compound Name | 2-[(2-anilino-4,4-dimethyl-6-oxocyclohexen-1-yl)-phenylmethyl]propanedinitrile |
| PubChem CID | 10474258 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 2-[(2-anilino-4,4-dimethyl-6-oxocyclohexen-1-yl)-phenylmethyl]propanedinitrile |
| SMILES | CC1(C)CC(=O)C(C(c2ccccc2)C(C#N)C#N)=C(Nc2ccccc2)C1 |
| InChI | InChI=1S/C24H23N3O/c1-24(2)13-20(27-19-11-7-4-8-12-19)23(21(28)14-24)22(18(15-25)16-26)17-9-5-3-6-10-17/h3-12,18,22,27H,13-14H2,1-2H3 |
| InChIKey | XKGHNMVLFBLBIM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2-anilino-4,4-dimethyl-6-oxocyclohexen-1-yl)-phenylmethyl]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-anilino-4,4-dimethyl-6-oxocyclohexen-1-yl)-phenylmethyl]propanedinitrile?
The IUPAC name of 2-[(2-anilino-4,4-dimethyl-6-oxocyclohexen-1-yl)-phenylmethyl]propanedinitrile (CID 10474258) is 2-[(2-anilino-4,4-dimethyl-6-oxocyclohexen-1-yl)-phenylmethyl]propanedinitrile.
What is the SMILES notation for 2-[(2-anilino-4,4-dimethyl-6-oxocyclohexen-1-yl)-phenylmethyl]propanedinitrile?
The canonical SMILES for 2-[(2-anilino-4,4-dimethyl-6-oxocyclohexen-1-yl)-phenylmethyl]propanedinitrile is CC1(C)CC(=O)C(C(c2ccccc2)C(C#N)C#N)=C(Nc2ccccc2)C1.
What is the InChIKey of 2-[(2-anilino-4,4-dimethyl-6-oxocyclohexen-1-yl)-phenylmethyl]propanedinitrile?
The InChIKey is XKGHNMVLFBLBIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23N3O/c1-24(2)13-20(27-19-11-7-4-8-12-19)23(21(28)14-24)22(18(15-25)16-26)17-9-5-3-6-10-17/h3-12,18,22,27H,13-14H2,1-2H3.
What are the key properties of 2-[(2-anilino-4,4-dimethyl-6-oxocyclohexen-1-yl)-phenylmethyl]propanedinitrile?
2-[(2-anilino-4,4-dimethyl-6-oxocyclohexen-1-yl)-phenylmethyl]propanedinitrile has a molecular weight of 369.47 g/mol, XLogP of 5.19, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-anilino-4,4-dimethyl-6-oxocyclohexen-1-yl)-phenylmethyl]propanedinitrile is sourced from PubChem (CID 10474258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).