About 2-[3-(4-chlorophenyl)-2-methyl-5-phenyl-3,4-dihydropyrazol-4-yl]-N,N-diethylethanamine
2-[3-(4-chlorophenyl)-2-methyl-5-phenyl-3,4-dihydropyrazol-4-yl]-N,N-diethylethanamine (PubChem CID 10474282) has the molecular formula C22H28ClN3
and a molecular weight of 369.94 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-2-methyl-5-phenyl-3,4-dihydropyrazol-4-yl]-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-[3-(4-chlorophenyl)-2-methyl-5-phenyl-3,4-dihydropyrazol-4-yl]-N,N-diethylethanamine |
| PubChem CID | 10474282 |
| Molecular Formula | C22H28ClN3 |
| Molecular Weight | 369.94 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-2-methyl-5-phenyl-3,4-dihydropyrazol-4-yl]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCC1C(c2ccccc2)=NN(C)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H28ClN3/c1-4-26(5-2)16-15-20-21(17-9-7-6-8-10-17)24-25(3)22(20)18-11-13-19(23)14-12-18/h6-14,20,22H,4-5,15-16H2,1-3H3 |
| InChIKey | KATLIWHBKOOPTD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.94 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3-(4-chlorophenyl)-2-methyl-5-phenyl-3,4-dihydropyrazol-4-yl]-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(4-chlorophenyl)-2-methyl-5-phenyl-3,4-dihydropyrazol-4-yl]-N,N-diethylethanamine?
The IUPAC name of 2-[3-(4-chlorophenyl)-2-methyl-5-phenyl-3,4-dihydropyrazol-4-yl]-N,N-diethylethanamine (CID 10474282) is 2-[3-(4-chlorophenyl)-2-methyl-5-phenyl-3,4-dihydropyrazol-4-yl]-N,N-diethylethanamine.
What is the SMILES notation for 2-[3-(4-chlorophenyl)-2-methyl-5-phenyl-3,4-dihydropyrazol-4-yl]-N,N-diethylethanamine?
The canonical SMILES for 2-[3-(4-chlorophenyl)-2-methyl-5-phenyl-3,4-dihydropyrazol-4-yl]-N,N-diethylethanamine is CCN(CC)CCC1C(c2ccccc2)=NN(C)C1c1ccc(Cl)cc1.
What is the InChIKey of 2-[3-(4-chlorophenyl)-2-methyl-5-phenyl-3,4-dihydropyrazol-4-yl]-N,N-diethylethanamine?
The InChIKey is KATLIWHBKOOPTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28ClN3/c1-4-26(5-2)16-15-20-21(17-9-7-6-8-10-17)24-25(3)22(20)18-11-13-19(23)14-12-18/h6-14,20,22H,4-5,15-16H2,1-3H3.
What are the key properties of 2-[3-(4-chlorophenyl)-2-methyl-5-phenyl-3,4-dihydropyrazol-4-yl]-N,N-diethylethanamine?
2-[3-(4-chlorophenyl)-2-methyl-5-phenyl-3,4-dihydropyrazol-4-yl]-N,N-diethylethanamine has a molecular weight of 369.94 g/mol, XLogP of 5.08, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(4-chlorophenyl)-2-methyl-5-phenyl-3,4-dihydropyrazol-4-yl]-N,N-diethylethanamine is sourced from PubChem (CID 10474282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).