C15H15N3O3 — CID 104743195
3-[(3,4-dimethylphenyl)carbamoylamino]pyridine-2-carboxylic acid (PubChem CID 104743195) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 3-[(3,4-dimethylphenyl)carbamoylamino]pyridine-2-carboxylic acid.
| Compound Name | 3-[(3,4-dimethylphenyl)carbamoylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 104743195 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 3-[(3,4-dimethylphenyl)carbamoylamino]pyridine-2-carboxylic acid |
| SMILES | Cc1ccc(NC(=O)Nc2cccnc2C(=O)O)cc1C |
| InChI | InChI=1S/C15H15N3O3/c1-9-5-6-11(8-10(9)2)17-15(21)18-12-4-3-7-16-13(12)14(19)20/h3-8H,1-2H3,(H,19,20)(H2,17,18,21) |
| InChIKey | CWWFZDGPLRNYEW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |