About 1-cyclohexyl-N-ethyl-N'-methyl-N'-phenylethane-1,2-diamine
1-cyclohexyl-N-ethyl-N'-methyl-N'-phenylethane-1,2-diamine (PubChem CID 104744322) has the molecular formula C17H28N2
and a molecular weight of 260.43 g/mol. Its IUPAC name is 1-cyclohexyl-N-ethyl-N'-methyl-N'-phenylethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-cyclohexyl-N-ethyl-N'-methyl-N'-phenylethane-1,2-diamine |
| PubChem CID | 104744322 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 1-cyclohexyl-N-ethyl-N'-methyl-N'-phenylethane-1,2-diamine |
| SMILES | CCNC(CN(C)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C17H28N2/c1-3-18-17(15-10-6-4-7-11-15)14-19(2)16-12-8-5-9-13-16/h5,8-9,12-13,15,17-18H,3-4,6-7,10-11,14H2,1-2H3 |
| InChIKey | IDARUQPHXCEVSE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclohexyl-N-ethyl-N'-methyl-N'-phenylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-N-ethyl-N'-methyl-N'-phenylethane-1,2-diamine?
The IUPAC name of 1-cyclohexyl-N-ethyl-N'-methyl-N'-phenylethane-1,2-diamine (CID 104744322) is 1-cyclohexyl-N-ethyl-N'-methyl-N'-phenylethane-1,2-diamine.
What is the SMILES notation for 1-cyclohexyl-N-ethyl-N'-methyl-N'-phenylethane-1,2-diamine?
The canonical SMILES for 1-cyclohexyl-N-ethyl-N'-methyl-N'-phenylethane-1,2-diamine is CCNC(CN(C)c1ccccc1)C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-N-ethyl-N'-methyl-N'-phenylethane-1,2-diamine?
The InChIKey is IDARUQPHXCEVSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2/c1-3-18-17(15-10-6-4-7-11-15)14-19(2)16-12-8-5-9-13-16/h5,8-9,12-13,15,17-18H,3-4,6-7,10-11,14H2,1-2H3.
What are the key properties of 1-cyclohexyl-N-ethyl-N'-methyl-N'-phenylethane-1,2-diamine?
1-cyclohexyl-N-ethyl-N'-methyl-N'-phenylethane-1,2-diamine has a molecular weight of 260.43 g/mol, XLogP of 3.68, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-N-ethyl-N'-methyl-N'-phenylethane-1,2-diamine is sourced from PubChem (CID 104744322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).