C17H28N2 — CID 104744322
1-cyclohexyl-N-ethyl-N'-methyl-N'-phenylethane-1,2-diamine (PubChem CID 104744322) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is 1-cyclohexyl-N-ethyl-N'-methyl-N'-phenylethane-1,2-diamine.
| Compound Name | 1-cyclohexyl-N-ethyl-N'-methyl-N'-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 104744322 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 1-cyclohexyl-N-ethyl-N'-methyl-N'-phenylethane-1,2-diamine |
| SMILES | CCNC(CN(C)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C17H28N2/c1-3-18-17(15-10-6-4-7-11-15)14-19(2)16-12-8-5-9-13-16/h5,8-9,12-13,15,17-18H,3-4,6-7,10-11,14H2,1-2H3 |
| InChIKey | IDARUQPHXCEVSE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |