About [(E)-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]amino] 4-methylbenzenesulfonate
[(E)-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]amino] 4-methylbenzenesulfonate (PubChem CID 10474476) has the molecular formula C16H14F3NO4S
and a molecular weight of 373.35 g/mol. Its IUPAC name is [(E)-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]amino] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [(E)-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]amino] 4-methylbenzenesulfonate |
| PubChem CID | 10474476 |
| Molecular Formula | C16H14F3NO4S |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | [(E)-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]amino] 4-methylbenzenesulfonate |
| SMILES | COc1cccc(/C(=N\OS(=O)(=O)c2ccc(C)cc2)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H14F3NO4S/c1-11-6-8-14(9-7-11)25(21,22)24-20-15(16(17,18)19)12-4-3-5-13(10-12)23-2/h3-10H,1-2H3/b20-15+ |
| InChIKey | KCTJTEAYEGHHCS-HMMYKYKNSA-N |
| XLogP | 3.68 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]amino] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]amino] 4-methylbenzenesulfonate?
The IUPAC name of [(E)-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]amino] 4-methylbenzenesulfonate (CID 10474476) is [(E)-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]amino] 4-methylbenzenesulfonate.
What is the SMILES notation for [(E)-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]amino] 4-methylbenzenesulfonate?
The canonical SMILES for [(E)-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]amino] 4-methylbenzenesulfonate is COc1cccc(/C(=N\OS(=O)(=O)c2ccc(C)cc2)C(F)(F)F)c1.
What is the InChIKey of [(E)-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]amino] 4-methylbenzenesulfonate?
The InChIKey is KCTJTEAYEGHHCS-HMMYKYKNSA-N. The full InChI is InChI=1S/C16H14F3NO4S/c1-11-6-8-14(9-7-11)25(21,22)24-20-15(16(17,18)19)12-4-3-5-13(10-12)23-2/h3-10H,1-2H3/b20-15+.
What are the key properties of [(E)-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]amino] 4-methylbenzenesulfonate?
[(E)-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]amino] 4-methylbenzenesulfonate has a molecular weight of 373.35 g/mol, XLogP of 3.68, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[2,2,2-trifluoro-1-(3-methoxyphenyl)ethylidene]amino] 4-methylbenzenesulfonate is sourced from PubChem (CID 10474476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).