C16H26N2O — CID 104745754
1-cyclohexyl-N'-(4-methoxyphenyl)-N'-methylethane-1,2-diamine (PubChem CID 104745754) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 1-cyclohexyl-N'-(4-methoxyphenyl)-N'-methylethane-1,2-diamine.
| Compound Name | 1-cyclohexyl-N'-(4-methoxyphenyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 104745754 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 1-cyclohexyl-N'-(4-methoxyphenyl)-N'-methylethane-1,2-diamine |
| SMILES | COc1ccc(N(C)CC(N)C2CCCCC2)cc1 |
| InChI | InChI=1S/C16H26N2O/c1-18(14-8-10-15(19-2)11-9-14)12-16(17)13-6-4-3-5-7-13/h8-11,13,16H,3-7,12,17H2,1-2H3 |
| InChIKey | VHONSZPKLDLCTF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|