C17H25N7OS — CID 10474610
10,13-bis[2-(dimethylamino)ethylamino]-6-thia-2,11,12-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7),4,10,12-pentaen-8-one (PubChem CID 10474610) has the molecular formula C17H25N7OS and a molecular weight of 375.50 g/mol. Its IUPAC name is 10,13-bis[2-(dimethylamino)ethylamino]-6-thia-2,11,12-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7),4,10,12-pentaen-8-one.
| Compound Name | 10,13-bis[2-(dimethylamino)ethylamino]-6-thia-2,11,12-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7),4,10,12-pentaen-8-one |
|---|---|
| PubChem CID | 10474610 |
| Molecular Formula | C17H25N7OS |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 10,13-bis[2-(dimethylamino)ethylamino]-6-thia-2,11,12-triazatricyclo[7.4.0.03,7]trideca-1(9),3(7),4,10,12-pentaen-8-one |
| SMILES | CN(C)CCNc1nnc(NCCN(C)C)c2c(=O)c3sccc3[nH]c12 |
| InChI | InChI=1S/C17H25N7OS/c1-23(2)8-6-18-16-12-13(17(22-21-16)19-7-9-24(3)4)20-11-5-10-26-15(11)14(12)25/h5,10H,6-9H2,1-4H3,(H,18,21)(H,19,22)(H,20,25) |
| InChIKey | HQFOZOLTOOPHDC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |