C23H28N4O — CID 10474679
[4-[4-(3,3,4-trimethylpiperazin-1-yl)anilino]quinolin-3-yl]methanol (PubChem CID 10474679) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is [4-[4-(3,3,4-trimethylpiperazin-1-yl)anilino]quinolin-3-yl]methanol.
| Compound Name | [4-[4-(3,3,4-trimethylpiperazin-1-yl)anilino]quinolin-3-yl]methanol |
|---|---|
| PubChem CID | 10474679 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | [4-[4-(3,3,4-trimethylpiperazin-1-yl)anilino]quinolin-3-yl]methanol |
| SMILES | CN1CCN(c2ccc(Nc3c(CO)cnc4ccccc34)cc2)CC1(C)C |
| InChI | InChI=1S/C23H28N4O/c1-23(2)16-27(13-12-26(23)3)19-10-8-18(9-11-19)25-22-17(15-28)14-24-21-7-5-4-6-20(21)22/h4-11,14,28H,12-13,15-16H2,1-3H3,(H,24,25) |
| InChIKey | SASCGBIFSTWAKB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 51.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|