C19H36N2 — CID 104746918
N-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1-cyclohexylethyl]propan-1-amine (PubChem CID 104746918) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is N-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1-cyclohexylethyl]propan-1-amine.
| Compound Name | N-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1-cyclohexylethyl]propan-1-amine |
|---|---|
| PubChem CID | 104746918 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | N-[2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-1-cyclohexylethyl]propan-1-amine |
| SMILES | CCCNC(CN1CCC2CCCCC21)C1CCCCC1 |
| InChI | InChI=1S/C19H36N2/c1-2-13-20-18(16-8-4-3-5-9-16)15-21-14-12-17-10-6-7-11-19(17)21/h16-20H,2-15H2,1H3 |
| InChIKey | RJYMNEWPYCHVEV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |