About pyridin-3-ylmethyl N-[[4-[(2-hydroxyphenyl)carbamoyl]phenyl]methyl]carbamate
pyridin-3-ylmethyl N-[[4-[(2-hydroxyphenyl)carbamoyl]phenyl]methyl]carbamate (PubChem CID 10474722) has the molecular formula C21H19N3O4
and a molecular weight of 377.40 g/mol. Its IUPAC name is pyridin-3-ylmethyl N-[[4-[(2-hydroxyphenyl)carbamoyl]phenyl]methyl]carbamate.
Molecular Properties
| Compound Name | pyridin-3-ylmethyl N-[[4-[(2-hydroxyphenyl)carbamoyl]phenyl]methyl]carbamate |
| PubChem CID | 10474722 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | pyridin-3-ylmethyl N-[[4-[(2-hydroxyphenyl)carbamoyl]phenyl]methyl]carbamate |
| SMILES | O=C(NCc1ccc(C(=O)Nc2ccccc2O)cc1)OCc1cccnc1 |
| InChI | InChI=1S/C21H19N3O4/c25-19-6-2-1-5-18(19)24-20(26)17-9-7-15(8-10-17)13-23-21(27)28-14-16-4-3-11-22-12-16/h1-12,25H,13-14H2,(H,23,27)(H,24,26) |
| InChIKey | UBDYONSSQMDKGM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze pyridin-3-ylmethyl N-[[4-[(2-hydroxyphenyl)carbamoyl]phenyl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-3-ylmethyl N-[[4-[(2-hydroxyphenyl)carbamoyl]phenyl]methyl]carbamate?
The IUPAC name of pyridin-3-ylmethyl N-[[4-[(2-hydroxyphenyl)carbamoyl]phenyl]methyl]carbamate (CID 10474722) is pyridin-3-ylmethyl N-[[4-[(2-hydroxyphenyl)carbamoyl]phenyl]methyl]carbamate.
What is the SMILES notation for pyridin-3-ylmethyl N-[[4-[(2-hydroxyphenyl)carbamoyl]phenyl]methyl]carbamate?
The canonical SMILES for pyridin-3-ylmethyl N-[[4-[(2-hydroxyphenyl)carbamoyl]phenyl]methyl]carbamate is O=C(NCc1ccc(C(=O)Nc2ccccc2O)cc1)OCc1cccnc1.
What is the InChIKey of pyridin-3-ylmethyl N-[[4-[(2-hydroxyphenyl)carbamoyl]phenyl]methyl]carbamate?
The InChIKey is UBDYONSSQMDKGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O4/c25-19-6-2-1-5-18(19)24-20(26)17-9-7-15(8-10-17)13-23-21(27)28-14-16-4-3-11-22-12-16/h1-12,25H,13-14H2,(H,23,27)(H,24,26).
What are the key properties of pyridin-3-ylmethyl N-[[4-[(2-hydroxyphenyl)carbamoyl]phenyl]methyl]carbamate?
pyridin-3-ylmethyl N-[[4-[(2-hydroxyphenyl)carbamoyl]phenyl]methyl]carbamate has a molecular weight of 377.40 g/mol, XLogP of 3.47, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-3-ylmethyl N-[[4-[(2-hydroxyphenyl)carbamoyl]phenyl]methyl]carbamate is sourced from PubChem (CID 10474722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).