About [(2S,4R)-4-(6-chloro-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate
[(2S,4R)-4-(6-chloro-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate (PubChem CID 10474818) has the molecular formula C16H12ClFN4O4
and a molecular weight of 378.75 g/mol. Its IUPAC name is [(2S,4R)-4-(6-chloro-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate.
Molecular Properties
| Compound Name | [(2S,4R)-4-(6-chloro-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate |
| PubChem CID | 10474818 |
| Molecular Formula | C16H12ClFN4O4 |
| Molecular Weight | 378.75 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | [(2S,4R)-4-(6-chloro-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1OC[C@H](n2cnc3c(Cl)nc(F)nc32)O1)c1ccccc1 |
| InChI | InChI=1S/C16H12ClFN4O4/c17-13-12-14(21-16(18)20-13)22(8-19-12)10-6-24-11(26-10)7-25-15(23)9-4-2-1-3-5-9/h1-5,8,10-11H,6-7H2/t10-,11+/m1/s1 |
| InChIKey | DMJLRWIGDSMHBG-MNOVXSKESA-N |
| XLogP | 2.35 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.75 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [(2S,4R)-4-(6-chloro-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4R)-4-(6-chloro-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate?
The IUPAC name of [(2S,4R)-4-(6-chloro-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate (CID 10474818) is [(2S,4R)-4-(6-chloro-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate.
What is the SMILES notation for [(2S,4R)-4-(6-chloro-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate?
The canonical SMILES for [(2S,4R)-4-(6-chloro-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate is O=C(OC[C@H]1OC[C@H](n2cnc3c(Cl)nc(F)nc32)O1)c1ccccc1.
What is the InChIKey of [(2S,4R)-4-(6-chloro-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate?
The InChIKey is DMJLRWIGDSMHBG-MNOVXSKESA-N. The full InChI is InChI=1S/C16H12ClFN4O4/c17-13-12-14(21-16(18)20-13)22(8-19-12)10-6-24-11(26-10)7-25-15(23)9-4-2-1-3-5-9/h1-5,8,10-11H,6-7H2/t10-,11+/m1/s1.
What are the key properties of [(2S,4R)-4-(6-chloro-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate?
[(2S,4R)-4-(6-chloro-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate has a molecular weight of 378.75 g/mol, XLogP of 2.35, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4R)-4-(6-chloro-2-fluoropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate is sourced from PubChem (CID 10474818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).