About N-[1-(oxolan-3-yl)-2-(2,2,2-trifluoroethoxy)ethyl]propan-1-amine
N-[1-(oxolan-3-yl)-2-(2,2,2-trifluoroethoxy)ethyl]propan-1-amine (PubChem CID 104748285) has the molecular formula C11H20F3NO2
and a molecular weight of 255.28 g/mol. Its IUPAC name is N-[1-(oxolan-3-yl)-2-(2,2,2-trifluoroethoxy)ethyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[1-(oxolan-3-yl)-2-(2,2,2-trifluoroethoxy)ethyl]propan-1-amine |
| PubChem CID | 104748285 |
| Molecular Formula | C11H20F3NO2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-[1-(oxolan-3-yl)-2-(2,2,2-trifluoroethoxy)ethyl]propan-1-amine |
| SMILES | CCCNC(COCC(F)(F)F)C1CCOC1 |
| InChI | InChI=1S/C11H20F3NO2/c1-2-4-15-10(9-3-5-16-6-9)7-17-8-11(12,13)14/h9-10,15H,2-8H2,1H3 |
| InChIKey | ANTVMSFEDORSTM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-(oxolan-3-yl)-2-(2,2,2-trifluoroethoxy)ethyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(oxolan-3-yl)-2-(2,2,2-trifluoroethoxy)ethyl]propan-1-amine?
The IUPAC name of N-[1-(oxolan-3-yl)-2-(2,2,2-trifluoroethoxy)ethyl]propan-1-amine (CID 104748285) is N-[1-(oxolan-3-yl)-2-(2,2,2-trifluoroethoxy)ethyl]propan-1-amine.
What is the SMILES notation for N-[1-(oxolan-3-yl)-2-(2,2,2-trifluoroethoxy)ethyl]propan-1-amine?
The canonical SMILES for N-[1-(oxolan-3-yl)-2-(2,2,2-trifluoroethoxy)ethyl]propan-1-amine is CCCNC(COCC(F)(F)F)C1CCOC1.
What is the InChIKey of N-[1-(oxolan-3-yl)-2-(2,2,2-trifluoroethoxy)ethyl]propan-1-amine?
The InChIKey is ANTVMSFEDORSTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F3NO2/c1-2-4-15-10(9-3-5-16-6-9)7-17-8-11(12,13)14/h9-10,15H,2-8H2,1H3.
What are the key properties of N-[1-(oxolan-3-yl)-2-(2,2,2-trifluoroethoxy)ethyl]propan-1-amine?
N-[1-(oxolan-3-yl)-2-(2,2,2-trifluoroethoxy)ethyl]propan-1-amine has a molecular weight of 255.28 g/mol, XLogP of 1.97, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(oxolan-3-yl)-2-(2,2,2-trifluoroethoxy)ethyl]propan-1-amine is sourced from PubChem (CID 104748285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).