About 4-O-benzyl 1-O-tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate
4-O-benzyl 1-O-tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (PubChem CID 10474854) has the molecular formula C20H29NO6
and a molecular weight of 379.45 g/mol. Its IUPAC name is 4-O-benzyl 1-O-tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate.
Molecular Properties
| Compound Name | 4-O-benzyl 1-O-tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| PubChem CID | 10474854 |
| Molecular Formula | C20H29NO6 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 4-O-benzyl 1-O-tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H29NO6/c1-19(2,3)26-17(23)15(21-18(24)27-20(4,5)6)12-16(22)25-13-14-10-8-7-9-11-14/h7-11,15H,12-13H2,1-6H3,(H,21,24)/t15-/m0/s1 |
| InChIKey | BFROBHITTVOPDW-HNNXBMFYSA-N |
| XLogP | 3.35 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze 4-O-benzyl 1-O-tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-benzyl 1-O-tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate?
The IUPAC name of 4-O-benzyl 1-O-tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (CID 10474854) is 4-O-benzyl 1-O-tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate.
What is the SMILES notation for 4-O-benzyl 1-O-tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate?
The canonical SMILES for 4-O-benzyl 1-O-tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate is CC(C)(C)OC(=O)N[C@@H](CC(=O)OCc1ccccc1)C(=O)OC(C)(C)C.
What is the InChIKey of 4-O-benzyl 1-O-tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate?
The InChIKey is BFROBHITTVOPDW-HNNXBMFYSA-N. The full InChI is InChI=1S/C20H29NO6/c1-19(2,3)26-17(23)15(21-18(24)27-20(4,5)6)12-16(22)25-13-14-10-8-7-9-11-14/h7-11,15H,12-13H2,1-6H3,(H,21,24)/t15-/m0/s1.
What are the key properties of 4-O-benzyl 1-O-tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate?
4-O-benzyl 1-O-tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate has a molecular weight of 379.45 g/mol, XLogP of 3.35, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-benzyl 1-O-tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate is sourced from PubChem (CID 10474854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).