C19H31NO — CID 104748853
1-cyclohexyl-N-ethyl-2-(2,3,5-trimethylphenoxy)ethanamine (PubChem CID 104748853) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is 1-cyclohexyl-N-ethyl-2-(2,3,5-trimethylphenoxy)ethanamine.
| Compound Name | 1-cyclohexyl-N-ethyl-2-(2,3,5-trimethylphenoxy)ethanamine |
|---|---|
| PubChem CID | 104748853 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | 1-cyclohexyl-N-ethyl-2-(2,3,5-trimethylphenoxy)ethanamine |
| SMILES | CCNC(COc1cc(C)cc(C)c1C)C1CCCCC1 |
| InChI | InChI=1S/C19H31NO/c1-5-20-18(17-9-7-6-8-10-17)13-21-19-12-14(2)11-15(3)16(19)4/h11-12,17-18,20H,5-10,13H2,1-4H3 |
| InChIKey | IROWYELPGSIVST-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |