C11H19F4NO2 — CID 104748994
N-ethyl-1-(oxolan-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 104748994) has the molecular formula C11H19F4NO2 and a molecular weight of 273.27 g/mol. Its IUPAC name is N-ethyl-1-(oxolan-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | N-ethyl-1-(oxolan-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 104748994 |
| Molecular Formula | C11H19F4NO2 |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | N-ethyl-1-(oxolan-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | CCNC(COCC(F)(F)C(F)F)C1CCOC1 |
| InChI | InChI=1S/C11H19F4NO2/c1-2-16-9(8-3-4-17-5-8)6-18-7-11(14,15)10(12)13/h8-10,16H,2-7H2,1H3 |
| InChIKey | PZSAVZWHZAFTBE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|