C10H17F4NO2 — CID 104748996
N-methyl-1-(oxolan-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 104748996) has the molecular formula C10H17F4NO2 and a molecular weight of 259.24 g/mol. Its IUPAC name is N-methyl-1-(oxolan-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | N-methyl-1-(oxolan-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 104748996 |
| Molecular Formula | C10H17F4NO2 |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-methyl-1-(oxolan-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | CNC(COCC(F)(F)C(F)F)C1CCOC1 |
| InChI | InChI=1S/C10H17F4NO2/c1-15-8(7-2-3-16-4-7)5-17-6-10(13,14)9(11)12/h7-9,15H,2-6H2,1H3 |
| InChIKey | JUWPHBFGTVQCKW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|