C12H21F4NO2 — CID 104749000
N-[1-(oxolan-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]propan-1-amine (PubChem CID 104749000) has the molecular formula C12H21F4NO2 and a molecular weight of 287.30 g/mol. Its IUPAC name is N-[1-(oxolan-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]propan-1-amine.
| Compound Name | N-[1-(oxolan-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 104749000 |
| Molecular Formula | C12H21F4NO2 |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | N-[1-(oxolan-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]propan-1-amine |
| SMILES | CCCNC(COCC(F)(F)C(F)F)C1CCOC1 |
| InChI | InChI=1S/C12H21F4NO2/c1-2-4-17-10(9-3-5-18-6-9)7-19-8-12(15,16)11(13)14/h9-11,17H,2-8H2,1H3 |
| InChIKey | AKPUTHLDBQKICW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|