About 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(oxolan-3-yl)ethanone
2-[methyl(2,2,2-trifluoroethyl)amino]-1-(oxolan-3-yl)ethanone (PubChem CID 104750089) has the molecular formula C9H14F3NO2
and a molecular weight of 225.21 g/mol. Its IUPAC name is 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(oxolan-3-yl)ethanone.
Molecular Properties
| Compound Name | 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(oxolan-3-yl)ethanone |
| PubChem CID | 104750089 |
| Molecular Formula | C9H14F3NO2 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(oxolan-3-yl)ethanone |
| SMILES | CN(CC(=O)C1CCOC1)CC(F)(F)F |
| InChI | InChI=1S/C9H14F3NO2/c1-13(6-9(10,11)12)4-8(14)7-2-3-15-5-7/h7H,2-6H2,1H3 |
| InChIKey | SCRBOSUOVAVKMQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(oxolan-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(oxolan-3-yl)ethanone?
The IUPAC name of 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(oxolan-3-yl)ethanone (CID 104750089) is 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(oxolan-3-yl)ethanone.
What is the SMILES notation for 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(oxolan-3-yl)ethanone?
The canonical SMILES for 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(oxolan-3-yl)ethanone is CN(CC(=O)C1CCOC1)CC(F)(F)F.
What is the InChIKey of 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(oxolan-3-yl)ethanone?
The InChIKey is SCRBOSUOVAVKMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3NO2/c1-13(6-9(10,11)12)4-8(14)7-2-3-15-5-7/h7H,2-6H2,1H3.
What are the key properties of 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(oxolan-3-yl)ethanone?
2-[methyl(2,2,2-trifluoroethyl)amino]-1-(oxolan-3-yl)ethanone has a molecular weight of 225.21 g/mol, XLogP of 1.09, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl(2,2,2-trifluoroethyl)amino]-1-(oxolan-3-yl)ethanone is sourced from PubChem (CID 104750089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).