C13H22N2O3 — CID 104750236
2-(4-acetyl-1,4-diazepan-1-yl)-1-(oxolan-3-yl)ethanone (PubChem CID 104750236) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-(4-acetyl-1,4-diazepan-1-yl)-1-(oxolan-3-yl)ethanone.
| Compound Name | 2-(4-acetyl-1,4-diazepan-1-yl)-1-(oxolan-3-yl)ethanone |
|---|---|
| PubChem CID | 104750236 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 2-(4-acetyl-1,4-diazepan-1-yl)-1-(oxolan-3-yl)ethanone |
| SMILES | CC(=O)N1CCCN(CC(=O)C2CCOC2)CC1 |
| InChI | InChI=1S/C13H22N2O3/c1-11(16)15-5-2-4-14(6-7-15)9-13(17)12-3-8-18-10-12/h12H,2-10H2,1H3 |
| InChIKey | CEEGVYNWNCHIPX-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |