C11H14N2O2 — CID 104751389
2-(2-cyclopentyl-2-oxoethyl)pyridazin-3-one (PubChem CID 104751389) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-(2-cyclopentyl-2-oxoethyl)pyridazin-3-one.
| Compound Name | 2-(2-cyclopentyl-2-oxoethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 104751389 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-(2-cyclopentyl-2-oxoethyl)pyridazin-3-one |
| SMILES | O=C(Cn1ncccc1=O)C1CCCC1 |
| InChI | InChI=1S/C11H14N2O2/c14-10(9-4-1-2-5-9)8-13-11(15)6-3-7-12-13/h3,6-7,9H,1-2,4-5,8H2 |
| InChIKey | JRXQEGJQCAHQKJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |