C12H15NO3 — CID 104751404
4-methyl-1-[2-oxo-2-(oxolan-3-yl)ethyl]pyridin-2-one (PubChem CID 104751404) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 4-methyl-1-[2-oxo-2-(oxolan-3-yl)ethyl]pyridin-2-one.
| Compound Name | 4-methyl-1-[2-oxo-2-(oxolan-3-yl)ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 104751404 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 4-methyl-1-[2-oxo-2-(oxolan-3-yl)ethyl]pyridin-2-one |
| SMILES | Cc1ccn(CC(=O)C2CCOC2)c(=O)c1 |
| InChI | InChI=1S/C12H15NO3/c1-9-2-4-13(12(15)6-9)7-11(14)10-3-5-16-8-10/h2,4,6,10H,3,5,7-8H2,1H3 |
| InChIKey | SCGKXNPWXSXPGY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |