About 4-(2-cyclopentyl-2-oxoethoxy)-3,5-dimethylbenzamide
4-(2-cyclopentyl-2-oxoethoxy)-3,5-dimethylbenzamide (PubChem CID 104752126) has the molecular formula C16H21NO3
and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-(2-cyclopentyl-2-oxoethoxy)-3,5-dimethylbenzamide.
Molecular Properties
| Compound Name | 4-(2-cyclopentyl-2-oxoethoxy)-3,5-dimethylbenzamide |
| PubChem CID | 104752126 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 4-(2-cyclopentyl-2-oxoethoxy)-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C(N)=O)cc(C)c1OCC(=O)C1CCCC1 |
| InChI | InChI=1S/C16H21NO3/c1-10-7-13(16(17)19)8-11(2)15(10)20-9-14(18)12-5-3-4-6-12/h7-8,12H,3-6,9H2,1-2H3,(H2,17,19) |
| InChIKey | PMRTXBYKSMMZLV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-cyclopentyl-2-oxoethoxy)-3,5-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-cyclopentyl-2-oxoethoxy)-3,5-dimethylbenzamide?
The IUPAC name of 4-(2-cyclopentyl-2-oxoethoxy)-3,5-dimethylbenzamide (CID 104752126) is 4-(2-cyclopentyl-2-oxoethoxy)-3,5-dimethylbenzamide.
What is the SMILES notation for 4-(2-cyclopentyl-2-oxoethoxy)-3,5-dimethylbenzamide?
The canonical SMILES for 4-(2-cyclopentyl-2-oxoethoxy)-3,5-dimethylbenzamide is Cc1cc(C(N)=O)cc(C)c1OCC(=O)C1CCCC1.
What is the InChIKey of 4-(2-cyclopentyl-2-oxoethoxy)-3,5-dimethylbenzamide?
The InChIKey is PMRTXBYKSMMZLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO3/c1-10-7-13(16(17)19)8-11(2)15(10)20-9-14(18)12-5-3-4-6-12/h7-8,12H,3-6,9H2,1-2H3,(H2,17,19).
What are the key properties of 4-(2-cyclopentyl-2-oxoethoxy)-3,5-dimethylbenzamide?
4-(2-cyclopentyl-2-oxoethoxy)-3,5-dimethylbenzamide has a molecular weight of 275.35 g/mol, XLogP of 2.54, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-cyclopentyl-2-oxoethoxy)-3,5-dimethylbenzamide is sourced from PubChem (CID 104752126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).