About 1-(oxolan-3-yl)-2-(1,1,1-trifluoropropan-2-yloxy)ethanone
1-(oxolan-3-yl)-2-(1,1,1-trifluoropropan-2-yloxy)ethanone (PubChem CID 104752137) has the molecular formula C9H13F3O3
and a molecular weight of 226.19 g/mol. Its IUPAC name is 1-(oxolan-3-yl)-2-(1,1,1-trifluoropropan-2-yloxy)ethanone.
Molecular Properties
| Compound Name | 1-(oxolan-3-yl)-2-(1,1,1-trifluoropropan-2-yloxy)ethanone |
| PubChem CID | 104752137 |
| Molecular Formula | C9H13F3O3 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 1-(oxolan-3-yl)-2-(1,1,1-trifluoropropan-2-yloxy)ethanone |
| SMILES | CC(OCC(=O)C1CCOC1)C(F)(F)F |
| InChI | InChI=1S/C9H13F3O3/c1-6(9(10,11)12)15-5-8(13)7-2-3-14-4-7/h6-7H,2-5H2,1H3 |
| InChIKey | RIDZQXDGVQARSF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(oxolan-3-yl)-2-(1,1,1-trifluoropropan-2-yloxy)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxolan-3-yl)-2-(1,1,1-trifluoropropan-2-yloxy)ethanone?
The IUPAC name of 1-(oxolan-3-yl)-2-(1,1,1-trifluoropropan-2-yloxy)ethanone (CID 104752137) is 1-(oxolan-3-yl)-2-(1,1,1-trifluoropropan-2-yloxy)ethanone.
What is the SMILES notation for 1-(oxolan-3-yl)-2-(1,1,1-trifluoropropan-2-yloxy)ethanone?
The canonical SMILES for 1-(oxolan-3-yl)-2-(1,1,1-trifluoropropan-2-yloxy)ethanone is CC(OCC(=O)C1CCOC1)C(F)(F)F.
What is the InChIKey of 1-(oxolan-3-yl)-2-(1,1,1-trifluoropropan-2-yloxy)ethanone?
The InChIKey is RIDZQXDGVQARSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3O3/c1-6(9(10,11)12)15-5-8(13)7-2-3-14-4-7/h6-7H,2-5H2,1H3.
What are the key properties of 1-(oxolan-3-yl)-2-(1,1,1-trifluoropropan-2-yloxy)ethanone?
1-(oxolan-3-yl)-2-(1,1,1-trifluoropropan-2-yloxy)ethanone has a molecular weight of 226.19 g/mol, XLogP of 1.56, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxolan-3-yl)-2-(1,1,1-trifluoropropan-2-yloxy)ethanone is sourced from PubChem (CID 104752137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).